C22H15BF8 — CID 174192227
(2,6-difluorophenyl)-bis[3-methyl-5-(trifluoromethyl)phenyl]borane (PubChem CID 174192227) has the molecular formula C22H15BF8 and a molecular weight of 442.16 g/mol. Its IUPAC name is (2,6-difluorophenyl)-bis[3-methyl-5-(trifluoromethyl)phenyl]borane.
| Compound Name | (2,6-difluorophenyl)-bis[3-methyl-5-(trifluoromethyl)phenyl]borane |
|---|---|
| PubChem CID | 174192227 |
| Molecular Formula | C22H15BF8 |
| Molecular Weight | 442.16 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (2,6-difluorophenyl)-bis[3-methyl-5-(trifluoromethyl)phenyl]borane |
| SMILES | Cc1cc(B(c2cc(C)cc(C(F)(F)F)c2)c2c(F)cccc2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15BF8/c1-12-6-14(21(26,27)28)10-16(8-12)23(20-18(24)4-3-5-19(20)25)17-9-13(2)7-15(11-17)22(29,30)31/h3-11H,1-2H3 |
| InChIKey | PNOKZYCVOCPAQS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.16 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|