C22H12BF11 — CID 174065330
[3-fluoro-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)borane (PubChem CID 174065330) has the molecular formula C22H12BF11 and a molecular weight of 496.13 g/mol. Its IUPAC name is [3-fluoro-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)borane.
| Compound Name | [3-fluoro-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)borane |
|---|---|
| PubChem CID | 174065330 |
| Molecular Formula | C22H12BF11 |
| Molecular Weight | 496.13 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | [3-fluoro-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)borane |
| SMILES | Cc1cc(B(c2cc(F)cc(C(F)(F)F)c2)c2c(F)c(F)c(C)c(F)c2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H12BF11/c1-9-3-11(21(29,30)31)5-13(4-9)23(14-6-12(22(32,33)34)7-15(24)8-14)16-19(27)17(25)10(2)18(26)20(16)28/h3-8H,1-2H3 |
| InChIKey | OHCKKUVHNDJDEU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.13 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|