C27H14BF19O — CID 162526437
bis[3,5-bis(trifluoromethyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane;oxolane (PubChem CID 162526437) has the molecular formula C27H14BF19O and a molecular weight of 726.18 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane;oxolane.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane;oxolane |
|---|---|
| PubChem CID | 162526437 |
| Molecular Formula | C27H14BF19O |
| Molecular Weight | 726.18 g/mol |
| Exact Mass | 726.08 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane;oxolane |
| SMILES | C1CCOC1.Fc1c(F)c(C(F)(F)F)c(F)c(F)c1B(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H6BF19.C4H8O/c25-15-13(23(41,42)43)16(26)18(28)14(17(15)27)24(11-3-7(19(29,30)31)1-8(4-11)20(32,33)34)12-5-9(21(35,36)37)2-10(6-12)22(38,39)40;1-2-4-5-3-1/h1-6H;1-4H2 |
| InChIKey | FFDJEUDPWCJGKM-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.18 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|