C20H14F13NO — CID 144913560
1-methyl-3,5-bis(trifluoromethyl)benzene;N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]butanamide (PubChem CID 144913560) has the molecular formula C20H14F13NO and a molecular weight of 531.31 g/mol. Its IUPAC name is 1-methyl-3,5-bis(trifluoromethyl)benzene;N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 1-methyl-3,5-bis(trifluoromethyl)benzene;N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 144913560 |
| Molecular Formula | C20H14F13NO |
| Molecular Weight | 531.31 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 1-methyl-3,5-bis(trifluoromethyl)benzene;N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F.Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F7NO.C9H6F6/c1-2-3-4(20)19-10-8(14)6(12)5(11(16,17)18)7(13)9(10)15;1-5-2-6(8(10,11)12)4-7(3-5)9(13,14)15/h2-3H2,1H3,(H,19,20);2-4H,1H3 |
| InChIKey | LJWAGOGTNRAETK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.31 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|