C21H18F7NO5 — CID 122467349
ethyl 2-[2,4-dimethoxy-5-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate (PubChem CID 122467349) has the molecular formula C21H18F7NO5 and a molecular weight of 497.36 g/mol. Its IUPAC name is ethyl 2-[2,4-dimethoxy-5-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate.
| Compound Name | ethyl 2-[2,4-dimethoxy-5-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 122467349 |
| Molecular Formula | C21H18F7NO5 |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | ethyl 2-[2,4-dimethoxy-5-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CC(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(OC)cc1OC |
| InChI | InChI=1S/C21H18F7NO5/c1-4-34-14(31)7-10-5-9(11(32-2)8-12(10)33-3)6-13(30)29-20-18(24)16(22)15(21(26,27)28)17(23)19(20)25/h5,8H,4,6-7H2,1-3H3,(H,29,30) |
| InChIKey | KRHKEXRTGXUUNM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|