C19H13F8NO3 — CID 122467251
ethyl 2-[4-fluoro-3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate (PubChem CID 122467251) has the molecular formula C19H13F8NO3 and a molecular weight of 455.30 g/mol. Its IUPAC name is ethyl 2-[4-fluoro-3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-fluoro-3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 122467251 |
| Molecular Formula | C19H13F8NO3 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | ethyl 2-[4-fluoro-3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(F)c(CC(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H13F8NO3/c1-2-31-12(30)6-8-3-4-10(20)9(5-8)7-11(29)28-18-16(23)14(21)13(19(25,26)27)15(22)17(18)24/h3-5H,2,6-7H2,1H3,(H,28,29) |
| InChIKey | ININDWMYUASDPD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|