C22H18F7NO3 — CID 122467207
ethyl 2-[8-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate (PubChem CID 122467207) has the molecular formula C22H18F7NO3 and a molecular weight of 477.38 g/mol. Its IUPAC name is ethyl 2-[8-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[8-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 122467207 |
| Molecular Formula | C22H18F7NO3 |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | ethyl 2-[8-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CCOC(=O)Cc1ccc2c(c1)C(C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)CCC2 |
| InChI | InChI=1S/C22H18F7NO3/c1-2-33-14(31)9-10-6-7-11-4-3-5-12(13(11)8-10)21(32)30-20-18(25)16(23)15(22(27,28)29)17(24)19(20)26/h6-8,12H,2-5,9H2,1H3,(H,30,32) |
| InChIKey | PMIXVYVNQFWPJV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|