C12H8F7NO3 — CID 4768380
5-oxo-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]pentanoic acid (PubChem CID 4768380) has the molecular formula C12H8F7NO3 and a molecular weight of 347.19 g/mol. Its IUPAC name is 5-oxo-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]pentanoic acid.
| Compound Name | 5-oxo-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 4768380 |
| Molecular Formula | C12H8F7NO3 |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 5-oxo-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]pentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C12H8F7NO3/c13-7-6(12(17,18)19)8(14)10(16)11(9(7)15)20-4(21)2-1-3-5(22)23/h1-3H2,(H,20,21)(H,22,23) |
| InChIKey | GNKPTLNYBYVYMO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|