C14H9ClF7N3O — CID 19553897
3-(4-chloro-5-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 19553897) has the molecular formula C14H9ClF7N3O and a molecular weight of 403.69 g/mol. Its IUPAC name is 3-(4-chloro-5-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(4-chloro-5-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 19553897 |
| Molecular Formula | C14H9ClF7N3O |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 3-(4-chloro-5-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1c(Cl)cnn1CCC(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14H9ClF7N3O/c1-5-6(15)4-23-25(5)3-2-7(26)24-13-11(18)9(16)8(14(20,21)22)10(17)12(13)19/h4H,2-3H2,1H3,(H,24,26) |
| InChIKey | NPBBBTVFZQRUTH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|