C14H8ClF8N3O — CID 19554159
3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 19554159) has the molecular formula C14H8ClF8N3O and a molecular weight of 421.68 g/mol. Its IUPAC name is 3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | 3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 19554159 |
| Molecular Formula | C14H8ClF8N3O |
| Molecular Weight | 421.68 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCC(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H8ClF8N3O/c1-4-6(15)13(14(21,22)23)25-26(4)3-2-5(27)24-12-10(19)8(17)7(16)9(18)11(12)20/h2-3H2,1H3,(H,24,27) |
| InChIKey | WCOLBOBTVLHIFL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|