C13H16F3NO3S — CID 101114075
N-[2,4-dimethyl-6-(trifluoromethylsulfonyl)phenyl]butanamide (PubChem CID 101114075) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is N-[2,4-dimethyl-6-(trifluoromethylsulfonyl)phenyl]butanamide.
| Compound Name | N-[2,4-dimethyl-6-(trifluoromethylsulfonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 101114075 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-[2,4-dimethyl-6-(trifluoromethylsulfonyl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1c(C)cc(C)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO3S/c1-4-5-11(18)17-12-9(3)6-8(2)7-10(12)21(19,20)13(14,15)16/h6-7H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | IDLWRAJQSSPTPD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |