C18H28N2O2 — CID 113122527
3-[acetyl(tert-butyl)amino]-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 113122527) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-[acetyl(tert-butyl)amino]-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 3-[acetyl(tert-butyl)amino]-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 113122527 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 3-[acetyl(tert-butyl)amino]-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1c(C)cc(C)cc1C)C(C)(C)C |
| InChI | InChI=1S/C18H28N2O2/c1-12-10-13(2)17(14(3)11-12)19-16(22)8-9-20(15(4)21)18(5,6)7/h10-11H,8-9H2,1-7H3,(H,19,22) |
| InChIKey | MHHRFMOUFPJNOD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |