C16H25NO3S2 — CID 47068848
4-(2-methylsulfonylethylsulfanyl)-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 47068848) has the molecular formula C16H25NO3S2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 4-(2-methylsulfonylethylsulfanyl)-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-(2-methylsulfonylethylsulfanyl)-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 47068848 |
| Molecular Formula | C16H25NO3S2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-(2-methylsulfonylethylsulfanyl)-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCSCCS(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C16H25NO3S2/c1-12-10-13(2)16(14(3)11-12)17-15(18)6-5-7-21-8-9-22(4,19)20/h10-11H,5-9H2,1-4H3,(H,17,18) |
| InChIKey | CWBVQKAAGRFLNO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|