C16H22N4OS — CID 7866650
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 7866650) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 7866650 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCSc2nncn2C)c(C)c1 |
| InChI | InChI=1S/C16H22N4OS/c1-11-8-12(2)15(13(3)9-11)18-14(21)6-5-7-22-16-19-17-10-20(16)4/h8-10H,5-7H2,1-4H3,(H,18,21) |
| InChIKey | LAQSBQNYNATISV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|