C23H30N2O2S — CID 31545161
4-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 31545161) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 4-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 31545161 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | CCc1ccccc1NC(=O)CSCCCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H30N2O2S/c1-5-19-9-6-7-10-20(19)24-22(27)15-28-12-8-11-21(26)25-23-17(3)13-16(2)14-18(23)4/h6-7,9-10,13-14H,5,8,11-12,15H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | SKQFKPZQVZJOSK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|