C23H29FN2O2S — CID 31090265
4-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 31090265) has the molecular formula C23H29FN2O2S and a molecular weight of 416.56 g/mol. Its IUPAC name is 4-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 31090265 |
| Molecular Formula | C23H29FN2O2S |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 4-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCSCC(=O)NCCc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C23H29FN2O2S/c1-16-13-17(2)23(18(3)14-16)26-21(27)5-4-12-29-15-22(28)25-11-10-19-6-8-20(24)9-7-19/h6-9,13-14H,4-5,10-12,15H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | SCMRKRQFOZSQJB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|