C20H25FN2O — CID 109024994
N-[2-(4-fluorophenyl)ethyl]-3-(2,4,6-trimethylanilino)propanamide (PubChem CID 109024994) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-3-(2,4,6-trimethylanilino)propanamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-3-(2,4,6-trimethylanilino)propanamide |
|---|---|
| PubChem CID | 109024994 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-3-(2,4,6-trimethylanilino)propanamide |
| SMILES | Cc1cc(C)c(NCCC(=O)NCCc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C20H25FN2O/c1-14-12-15(2)20(16(3)13-14)23-11-9-19(24)22-10-8-17-4-6-18(21)7-5-17/h4-7,12-13,23H,8-11H2,1-3H3,(H,22,24) |
| InChIKey | MBVQMTOMDGTGKH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |