C19H22FNO — CID 94866860
3-(4-ethylphenyl)-N-[2-(4-fluorophenyl)ethyl]propanamide (PubChem CID 94866860) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-N-[2-(4-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(4-ethylphenyl)-N-[2-(4-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 94866860 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-(4-ethylphenyl)-N-[2-(4-fluorophenyl)ethyl]propanamide |
| SMILES | CCc1ccc(CCC(=O)NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FNO/c1-2-15-3-5-16(6-4-15)9-12-19(22)21-14-13-17-7-10-18(20)11-8-17/h3-8,10-11H,2,9,12-14H2,1H3,(H,21,22) |
| InChIKey | QGXNZENWXUILEA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |