C18H22FN2O+ — CID 8860908
2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 8860908) has the molecular formula C18H22FN2O+ and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8860908 |
| Molecular Formula | C18H22FN2O+ |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CCc1ccc(C)[n+](CC(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H21FN2O/c1-3-15-5-4-14(2)21(12-15)13-18(22)20-11-10-16-6-8-17(19)9-7-16/h4-9,12H,3,10-11,13H2,1-2H3/p+1 |
| InChIKey | JYCWSVOXTMTNCV-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|