C17H20FN2O+ — CID 8860911
2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 8860911) has the molecular formula C17H20FN2O+ and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8860911 |
| Molecular Formula | C17H20FN2O+ |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCc1ccc(C)[n+](CC(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H19FN2O/c1-3-14-5-4-13(2)20(11-14)12-17(21)19-10-15-6-8-16(18)9-7-15/h4-9,11H,3,10,12H2,1-2H3/p+1 |
| InChIKey | HLMLCNKGJKHKJU-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|