C14H15FN2O — CID 112528395
N-[(4-fluorophenyl)methyl]-2-(5-methyl-1H-pyrrol-3-yl)acetamide (PubChem CID 112528395) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(5-methyl-1H-pyrrol-3-yl)acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(5-methyl-1H-pyrrol-3-yl)acetamide |
|---|---|
| PubChem CID | 112528395 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(5-methyl-1H-pyrrol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NCc2ccc(F)cc2)c[nH]1 |
| InChI | InChI=1S/C14H15FN2O/c1-10-6-12(9-16-10)7-14(18)17-8-11-2-4-13(15)5-3-11/h2-6,9,16H,7-8H2,1H3,(H,17,18) |
| InChIKey | VKVCIORMGRMAMZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |