C17H21FN3O+ — CID 8863393
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 8863393) has the molecular formula C17H21FN3O+ and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8863393 |
| Molecular Formula | C17H21FN3O+ |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CN(C)c1cc[n+](CC(=O)NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H20FN3O/c1-20(2)16-8-11-21(12-9-16)13-17(22)19-10-7-14-3-5-15(18)6-4-14/h3-6,8-9,11-12H,7,10,13H2,1-2H3/p+1 |
| InChIKey | LIELPRZTKGWVLE-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 36.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|