C23H27FN3O+ — CID 8864336
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 8864336) has the molecular formula C23H27FN3O+ and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 8864336 |
| Molecular Formula | C23H27FN3O+ |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)C[n+]2ccc(N(C)C)cc2)c(C)n1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN3O/c1-17-15-22(23(28)16-26-12-10-21(11-13-26)25(3)4)18(2)27(17)14-9-19-5-7-20(24)8-6-19/h5-8,10-13,15H,9,14,16H2,1-4H3/q+1 |
| InChIKey | QELASSMUGJIDEB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|