C25H23F2NO3 — CID 3895825
[2-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 3895825) has the molecular formula C25H23F2NO3 and a molecular weight of 423.46 g/mol. Its IUPAC name is [2-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3895825 |
| Molecular Formula | C25H23F2NO3 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)C=Cc2ccc(F)cc2)c(C)n1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H23F2NO3/c1-17-15-23(18(2)28(17)14-13-20-5-10-22(27)11-6-20)24(29)16-31-25(30)12-7-19-3-8-21(26)9-4-19/h3-12,15H,13-14,16H2,1-2H3 |
| InChIKey | MFBALFNWOKUGGX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|