C18H18FNO3 — CID 4242907
[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 4242907) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4242907 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)C=Cc2ccc(F)cc2)c(C)n1C |
| InChI | InChI=1S/C18H18FNO3/c1-12-10-16(13(2)20(12)3)17(21)11-23-18(22)9-6-14-4-7-15(19)8-5-14/h4-10H,11H2,1-3H3 |
| InChIKey | OREMULXHBQDEJP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|