C17H16FN3O5 — CID 3302101
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 3302101) has the molecular formula C17H16FN3O5 and a molecular weight of 361.33 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3302101 |
| Molecular Formula | C17H16FN3O5 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cn1c(N)c(C(=O)COC(=O)C=Cc2ccc(F)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H16FN3O5/c1-20-15(19)14(16(24)21(2)17(20)25)12(22)9-26-13(23)8-5-10-3-6-11(18)7-4-10/h3-8H,9,19H2,1-2H3 |
| InChIKey | LYHJUNHJXOHRNT-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|