C24H20F3N3O5 — CID 3342102
[2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 3342102) has the molecular formula C24H20F3N3O5 and a molecular weight of 487.43 g/mol. Its IUPAC name is [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3342102 |
| Molecular Formula | C24H20F3N3O5 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | Cn1c(=O)c(C(=O)COC(=O)C=Cc2cccc(C(F)(F)F)c2)c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C24H20F3N3O5/c1-29-22(33)20(21(28)30(23(29)34)13-16-6-3-2-4-7-16)18(31)14-35-19(32)11-10-15-8-5-9-17(12-15)24(25,26)27/h2-12H,13-14,28H2,1H3 |
| InChIKey | SZSHIQXFBRZMKH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|