C25H27FN2O3 — CID 7919112
2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxy-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 7919112) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is 2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxy-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxy-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 7919112 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxy-1-[1-[2-(4-fluorophenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | CCOc1ccc(/C=N\OCC(=O)c2cc(C)n(CCc3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C25H27FN2O3/c1-4-30-23-11-7-21(8-12-23)16-27-31-17-25(29)24-15-18(2)28(19(24)3)14-13-20-5-9-22(26)10-6-20/h5-12,15-16H,4,13-14,17H2,1-3H3/b27-16- |
| InChIKey | QFIGUBHUNBNIKA-YUMHPJSZSA-N |
| XLogP | 5.12 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|