C24H30N3O2+ — CID 8864329
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 8864329) has the molecular formula C24H30N3O2+ and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 8864329 |
| Molecular Formula | C24H30N3O2+ |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COc1ccc(CCn2c(C)cc(C(=O)C[n+]3ccc(N(C)C)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H30N3O2/c1-18-16-23(24(28)17-26-13-11-21(12-14-26)25(3)4)19(2)27(18)15-10-20-6-8-22(29-5)9-7-20/h6-9,11-14,16H,10,15,17H2,1-5H3/q+1 |
| InChIKey | AICYFUKNEDDTJI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|