C23H28N3O+ — CID 8864327
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]ethanone (PubChem CID 8864327) has the molecular formula C23H28N3O+ and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 8864327 |
| Molecular Formula | C23H28N3O+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)C[n+]2ccc(N(C)C)cc2)c(C)n1CCc1ccccc1 |
| InChI | InChI=1S/C23H28N3O/c1-18-16-22(19(2)26(18)15-10-20-8-6-5-7-9-20)23(27)17-25-13-11-21(12-14-25)24(3)4/h5-9,11-14,16H,10,15,17H2,1-4H3/q+1 |
| InChIKey | OOVVQNAMZPLETQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|