C25H29N2O2+ — CID 8859796
2-(4-benzylpyridin-1-ium-1-yl)-1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]ethanone (PubChem CID 8859796) has the molecular formula C25H29N2O2+ and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-(4-benzylpyridin-1-ium-1-yl)-1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]ethanone.
| Compound Name | 2-(4-benzylpyridin-1-ium-1-yl)-1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 8859796 |
| Molecular Formula | C25H29N2O2+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-(4-benzylpyridin-1-ium-1-yl)-1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)C[n+]2ccc(Cc3ccccc3)cc2)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C25H29N2O2/c1-19-15-24(20(2)27(19)17-23-9-6-14-29-23)25(28)18-26-12-10-22(11-13-26)16-21-7-4-3-5-8-21/h3-5,7-8,10-13,15,23H,6,9,14,16-18H2,1-2H3/q+1/t23-/m0/s1 |
| InChIKey | YWXMRMZYUNLUFP-QHCPKHFHSA-N |
| XLogP | 4.05 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|