C20H27N2O2+ — CID 8857090
1-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone (PubChem CID 8857090) has the molecular formula C20H27N2O2+ and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8857090 |
| Molecular Formula | C20H27N2O2+ |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone |
| SMILES | CCc1cc[n+](CC(=O)c2cc(C)n(C[C@H]3CCCO3)c2C)cc1 |
| InChI | InChI=1S/C20H27N2O2/c1-4-17-7-9-21(10-8-17)14-20(23)19-12-15(2)22(16(19)3)13-18-6-5-11-24-18/h7-10,12,18H,4-6,11,13-14H2,1-3H3/q+1/t18-/m1/s1 |
| InChIKey | GPZUKPVPAFCLCO-GOSISDBHSA-N |
| XLogP | 3.02 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|