C21H29N2O2+ — CID 8861640
1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)ethanone (PubChem CID 8861640) has the molecular formula C21H29N2O2+ and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8861640 |
| Molecular Formula | C21H29N2O2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)ethanone |
| SMILES | CCc1ccc(C)[n+](CC(=O)c2cc(C)n(C[C@@H]3CCCO3)c2C)c1 |
| InChI | InChI=1S/C21H29N2O2/c1-5-18-9-8-15(2)22(12-18)14-21(24)20-11-16(3)23(17(20)4)13-19-7-6-10-25-19/h8-9,11-12,19H,5-7,10,13-14H2,1-4H3/q+1/t19-/m0/s1 |
| InChIKey | ZLHKWGSUTWSNDV-IBGZPJMESA-N |
| XLogP | 3.33 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|