C24H27N2O2+ — CID 8876308
1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)ethanone (PubChem CID 8876308) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8876308 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 1-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)ethanone |
| SMILES | Cc1cc(C(=O)C[n+]2cccc(-c3ccccc3)c2)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C24H27N2O2/c1-18-14-23(19(2)26(18)16-22-11-7-13-28-22)24(27)17-25-12-6-10-21(15-25)20-8-4-3-5-9-20/h3-6,8-10,12,14-15,22H,7,11,13,16-17H2,1-2H3/q+1/t22-/m0/s1 |
| InChIKey | HWTDAXMJMDWBBV-QFIPXVFZSA-N |
| XLogP | 4.12 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|