C20H33N2O2+ — CID 8875694
cyclopentyl-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]-dimethylazanium (PubChem CID 8875694) has the molecular formula C20H33N2O2+ and a molecular weight of 333.50 g/mol. Its IUPAC name is cyclopentyl-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]-dimethylazanium.
| Compound Name | cyclopentyl-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8875694 |
| Molecular Formula | C20H33N2O2+ |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | cyclopentyl-[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl]-dimethylazanium |
| SMILES | Cc1cc(C(=O)C[N+](C)(C)C2CCCC2)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H33N2O2/c1-15-12-19(16(2)21(15)13-18-10-7-11-24-18)20(23)14-22(3,4)17-8-5-6-9-17/h12,17-18H,5-11,13-14H2,1-4H3/q+1/t18-/m0/s1 |
| InChIKey | BXBYBZPXYOLICV-SFHVURJKSA-N |
| XLogP | 3.49 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|