C25H22Cl2N2O4 — CID 2490696
5,6-dichloro-2-[2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 2490696) has the molecular formula C25H22Cl2N2O4 and a molecular weight of 485.37 g/mol. Its IUPAC name is 5,6-dichloro-2-[2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2490696 |
| Molecular Formula | C25H22Cl2N2O4 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 5,6-dichloro-2-[2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(CCn2c(C)cc(C(=O)CN3C(=O)c4cc(Cl)c(Cl)cc4C3=O)c2C)cc1 |
| InChI | InChI=1S/C25H22Cl2N2O4/c1-14-10-18(15(2)28(14)9-8-16-4-6-17(33-3)7-5-16)23(30)13-29-24(31)19-11-21(26)22(27)12-20(19)25(29)32/h4-7,10-12H,8-9,13H2,1-3H3 |
| InChIKey | VGJSYAGGFYUJML-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|