C24H21N3O5 — CID 41476389
2-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione (PubChem CID 41476389) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 41476389 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c(C)n1CCc1ccccc1 |
| InChI | InChI=1S/C24H21N3O5/c1-15-12-20(16(2)25(15)11-10-17-6-4-3-5-7-17)22(28)14-26-23(29)19-9-8-18(27(31)32)13-21(19)24(26)30/h3-9,12-13H,10-11,14H2,1-2H3 |
| InChIKey | DBNXYRWIALVPFZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|