C21H15N5O5 — CID 27011267
2-(1,3-dimethylbenzimidazol-2-ylidene)-4-(5-nitro-1,3-dioxoisoindol-2-yl)-3-oxobutanenitrile (PubChem CID 27011267) has the molecular formula C21H15N5O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-(5-nitro-1,3-dioxoisoindol-2-yl)-3-oxobutanenitrile.
| Compound Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-(5-nitro-1,3-dioxoisoindol-2-yl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 27011267 |
| Molecular Formula | C21H15N5O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-(5-nitro-1,3-dioxoisoindol-2-yl)-3-oxobutanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H15N5O5/c1-23-16-5-3-4-6-17(16)24(2)19(23)15(10-22)18(27)11-25-20(28)13-8-7-12(26(30)31)9-14(13)21(25)29/h3-9H,11H2,1-2H3 |
| InChIKey | BQEXFQYADJXTOB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 127.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|