C19H15Cl2NO5 — CID 40698469
2-(4-methoxyphenyl)ethyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 40698469) has the molecular formula C19H15Cl2NO5 and a molecular weight of 408.24 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | 2-(4-methoxyphenyl)ethyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 40698469 |
| Molecular Formula | C19H15Cl2NO5 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COc1ccc(CCOC(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C19H15Cl2NO5/c1-26-12-4-2-11(3-5-12)6-7-27-17(23)10-22-18(24)13-8-15(20)16(21)9-14(13)19(22)25/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | ZLMAOOUXLWYTNX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|