C17H13Cl2N3O6 — CID 55479058
(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 55479058) has the molecular formula C17H13Cl2N3O6 and a molecular weight of 426.21 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55479058 |
| Molecular Formula | C17H13Cl2N3O6 |
| Molecular Weight | 426.21 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | Cn1c(COC(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C17H13Cl2N3O6/c1-20-8(3-13(23)21(2)17(20)27)7-28-14(24)6-22-15(25)9-4-11(18)12(19)5-10(9)16(22)26/h3-5H,6-7H2,1-2H3 |
| InChIKey | YPYBPLFILMHUBY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 107.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|