C17H18Cl2N2O5 — CID 8849399
methyl (2R)-2-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoate (PubChem CID 8849399) has the molecular formula C17H18Cl2N2O5 and a molecular weight of 401.25 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 8849399 |
| Molecular Formula | C17H18Cl2N2O5 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | methyl (2R)-2-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C17H18Cl2N2O5/c1-8(2)4-13(17(25)26-3)20-14(22)7-21-15(23)9-5-11(18)12(19)6-10(9)16(21)24/h5-6,8,13H,4,7H2,1-3H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | YPDQSFIYQNFHMU-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|