C16H17BrN2O5 — CID 119188059
2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoic acid (PubChem CID 119188059) has the molecular formula C16H17BrN2O5 and a molecular weight of 397.23 g/mol. Its IUPAC name is 2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188059 |
| Molecular Formula | C16H17BrN2O5 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-[[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)CN1C(=O)c2ccc(Br)cc2C1=O)C(=O)O |
| InChI | InChI=1S/C16H17BrN2O5/c1-8(2)5-12(16(23)24)18-13(20)7-19-14(21)10-4-3-9(17)6-11(10)15(19)22/h3-4,6,8,12H,5,7H2,1-2H3,(H,18,20)(H,23,24) |
| InChIKey | JJFZMRGKSRXWJC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|