C17H20N2O5 — CID 119364791
(2R)-4-methyl-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]pentanoic acid (PubChem CID 119364791) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2R)-4-methyl-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119364791 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2R)-4-methyl-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]pentanoic acid |
| SMILES | Cc1ccc2c(c1)C(=O)N(CC(=O)N[C@H](CC(C)C)C(=O)O)C2=O |
| InChI | InChI=1S/C17H20N2O5/c1-9(2)6-13(17(23)24)18-14(20)8-19-15(21)11-5-4-10(3)7-12(11)16(19)22/h4-5,7,9,13H,6,8H2,1-3H3,(H,18,20)(H,23,24)/t13-/m1/s1 |
| InChIKey | GYFJBPXAWCLJPM-CYBMUJFWSA-N |
| XLogP | 1.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|