C14H19N3O6 — CID 120679225
4-methyl-2-[[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]amino]pentanoic acid (PubChem CID 120679225) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-methyl-2-[[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120679225 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-methyl-2-[[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]amino]pentanoic acid |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)NC(CC(C)C)C(=O)O)C1=O |
| InChI | InChI=1S/C14H19N3O6/c1-4-5-16-11(19)12(20)17(14(16)23)7-10(18)15-9(13(21)22)6-8(2)3/h4,8-9H,1,5-7H2,2-3H3,(H,15,18)(H,21,22) |
| InChIKey | OLFIFVCNMCFLIV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|