C17H27N3O5 — CID 119361468
(2S)-4-methyl-2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid (PubChem CID 119361468) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119361468 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (2S)-4-methyl-2-[[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CN1C(=O)N(C)C2(CCCCC2)C1=O)C(=O)O |
| InChI | InChI=1S/C17H27N3O5/c1-11(2)9-12(14(22)23)18-13(21)10-20-15(24)17(19(3)16(20)25)7-5-4-6-8-17/h11-12H,4-10H2,1-3H3,(H,18,21)(H,22,23)/t12-/m0/s1 |
| InChIKey | SKXPNFZUBGQVRB-LBPRGKRZSA-N |
| XLogP | 1.20 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|