C17H20N2O5 — CID 120614308
(2S)-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]hexanoic acid (PubChem CID 120614308) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2S)-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120614308 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2S)-2-[[2-(5-methyl-1,3-dioxoisoindol-2-yl)acetyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CN1C(=O)c2ccc(C)cc2C1=O)C(=O)O |
| InChI | InChI=1S/C17H20N2O5/c1-3-4-5-13(17(23)24)18-14(20)9-19-15(21)11-7-6-10(2)8-12(11)16(19)22/h6-8,13H,3-5,9H2,1-2H3,(H,18,20)(H,23,24)/t13-/m0/s1 |
| InChIKey | AFQRXINBPZDZAT-ZDUSSCGKSA-N |
| XLogP | 1.35 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|