C19H24N2O5 — CID 119364341
(2R)-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119364341) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R)-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119364341 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (2R)-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N[C@H](CC(C)C)C(=O)O)cc2C1=O |
| InChI | InChI=1S/C19H24N2O5/c1-4-5-8-21-17(23)13-7-6-12(10-14(13)18(21)24)16(22)20-15(19(25)26)9-11(2)3/h6-7,10-11,15H,4-5,8-9H2,1-3H3,(H,20,22)(H,25,26)/t15-/m1/s1 |
| InChIKey | NVNAPNUJCXECCH-OAHLLOKOSA-N |
| XLogP | 2.31 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|