C17H23N3O3 — CID 119498610
N-(3-aminobutyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 119498610) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3-aminobutyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 119498610 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(3-aminobutyl)-2-butyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)NCCC(C)N)cc2C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-3-4-9-20-16(22)13-6-5-12(10-14(13)17(20)23)15(21)19-8-7-11(2)18/h5-6,10-11H,3-4,7-9,18H2,1-2H3,(H,19,21) |
| InChIKey | OPBZDIJFTZVHTL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|