C20H16Cl2N2O6 — CID 35776787
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 35776787) has the molecular formula C20H16Cl2N2O6 and a molecular weight of 451.26 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 35776787 |
| Molecular Formula | C20H16Cl2N2O6 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COc1ccccc1CNC(=O)COC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C20H16Cl2N2O6/c1-29-16-5-3-2-4-11(16)8-23-17(25)10-30-18(26)9-24-19(27)12-6-14(21)15(22)7-13(12)20(24)28/h2-7H,8-10H2,1H3,(H,23,25) |
| InChIKey | GADXRWJNZMROGF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|