C19H22ClFN2O — CID 109025156
N-(2-chloro-4,6-dimethylphenyl)-3-[2-(4-fluorophenyl)ethylamino]propanamide (PubChem CID 109025156) has the molecular formula C19H22ClFN2O and a molecular weight of 348.85 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-[2-(4-fluorophenyl)ethylamino]propanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-[2-(4-fluorophenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109025156 |
| Molecular Formula | C19H22ClFN2O |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-[2-(4-fluorophenyl)ethylamino]propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCNCCc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClFN2O/c1-13-11-14(2)19(17(20)12-13)23-18(24)8-10-22-9-7-15-3-5-16(21)6-4-15/h3-6,11-12,22H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | XSTYFETWLBUYEE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|